| Name | 2-BROMO-5-METHOXYPYRIDINE |
| Synonyms | T6NJ BE EO1 [WLN] 2-BROMO-5-METHOXYPYRIDINE Pyridine,2-bromo-5-methoxy- Pyridine, 2-bromo-5-methoxy- |
| CAS | 105170-27-2 |
| InChI | InChI=1/C6H6BrNO/c1-9-5-2-3-6(7)8-4-5/h2-4H,1H3 |
| Molecular Formula | C6H6BrNO |
| Molar Mass | 188.02 |
| Density | 1.530±0.06 g/cm3(Predicted) |
| Melting Point | 22 °C |
| Boling Point | 113 °C(Press: 59 Torr) |
| Flash Point | 99.4°C |
| Vapor Presure | 0.0577mmHg at 25°C |
| pKa | -2.22±0.10(Predicted) |
| Storage Condition | Inert atmosphere,Room Temperature |
| Refractive Index | 1.542 |
| Hazard Symbols | Xi - Irritant![]() |
| Hazard Note | Irritant |
| Use | 2-bromo-5-methoxypyridine is a heterocyclic derivative and can be used as an intermediate in organic synthesis. |
| preparation | 2-bromo-5-methoxypyridine can be prepared from 2, 2-bromo-5-hydroxypyridine was prepared using 5-dibromopyridine as raw material, and then obtained by methylation. |